raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 25+ )
Otras preguntas
If you use the eight digits 1,2,3,4,5,6,7 and 9 each once and ONLY once to form 4 two-digit prime numbers. What will be the sum of the four prime numbers you cr
HELP PLEASE ASAP! Analyze the diagram below. Each segment of the umbrella appears to be a different color. Explain why each section appears to be the color that
A survey collected data from a random sample of 121 people living in Jade oty. The sample average of the distance people travel to reach their workplaces (Y) is
A survey collected data from a random sample of 121 people living in Jade oty. The sample average of the distance people travel to reach their workplaces (Y) is
There are 30 cans of soda in the refrigerator. The table shows how many cans there are of each type. If you reach in and pull out one can of soda, what is the p
A bag contains 10 green,8 blue, and 2 white balls. Naomi seclets 2 balls from the bag at random, one at a time, without replacing them. What is the probability
When the dimensions of a cube are doubled, 0 the surface area and the volume are doubled the surface area is doubled and the volume is quadrupled 0 the surface
a certain reaction has delta h= -75 kj mol and an activation energyh What is the activation energy of the reverse reaction?
HELP PLEASE ASAP! Analyze the diagram below. Each segment of the umbrella appears to be a different color. Explain why each section appears to be the color that
Given the lengths of two sides of a triangle. write an inequality to indicate between which two numbers the length of the third side must fall. a.8 and 13. b.11
